CAS 171178-41-9

N-Boc-5-amino-2-fluoropyridine

Description:

N-Boc-5-amino-2-fluoropyridine is a chemical compound characterized by its pyridine ring, which contains both an amino group and a fluorine atom. The "N-Boc" designation indicates that the amino group is protected by a tert-butyloxycarbonyl (Boc) group, a common protective group in organic synthesis that enhances the stability and reactivity of the amine. This compound is typically used in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its pharmacokinetic profile. N-Boc-5-amino-2-fluoropyridine is usually handled with standard laboratory precautions, as with many organic compounds, and its reactivity can be influenced by the conditions under which it is used, such as temperature and solvent choice.

Formula: C₁₀H₁₃FN₂O₂

InChI: InChI=1/C10H13FN2O2/c1-10(2,3)15-9(14)13-7-4-5-8(11)12-6-7/h4-6H,1-3H3,(H,13,14)

SMILES: CC(C)(C)OC(=Nc1ccc(F)nc1)O

Synonyms:

• Boc-5-Amino-2-Fluoropyridine
• Tert-Butyl 6-Fluoropyridin-3-Ylcarbamate
• Carbamic acid, (6-fluoro-3-pyridinyl)-, 1,1-dimethylethyl ester (9CI)

tert-Butyl (6-fluoropyridin-3-yl)carbamate

CAS: 171178-41-9

Formula: C₁₀H₁₃FN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.2208

Ref: IN-DA0077TI

tert-Butyl (6-fluoropyridin-3-yl)carbamate

CAS: 171178-41-9

tert-Butyl (6-fluoropyridin-3-yl)carbamate

Purity: 97%

Molecular weight: 212.22g/mol

Ref: 54-PC100242

tert-Butyl (6-fluoropyridin-3-yl)carbamate

CAS: 171178-41-9

Formula: C₁₀H₁₃FN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.224

Ref: 10-F319689