CAS 17119-15-2
:3-Hydroxymandelic acid
Description:
3-Hydroxymandelic acid, with the CAS number 17119-15-2, is an aromatic organic compound characterized by its hydroxyl and carboxylic acid functional groups. It is a derivative of mandelic acid, featuring a hydroxyl group positioned at the meta position relative to the carboxylic acid group on the benzene ring. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which enhances its utility in biochemical applications. 3-Hydroxymandelic acid is known for its potential role in metabolic pathways and may exhibit biological activity, including antioxidant properties. Its structural features contribute to its reactivity and interactions with other molecules, making it of interest in pharmaceutical and medicinal chemistry. Additionally, it can serve as a precursor in the synthesis of other chemical compounds. As with many organic acids, it may exhibit acidity and can participate in various chemical reactions, including esterification and amidation. Proper handling and storage conditions are essential to maintain its stability and efficacy in research and application contexts.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)
InChI key:InChIKey=OLSDAJRAVOVKLG-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=CC(O)=CC=C1
Synonyms:- (±)-m-Hydroxymandelic acid
- 2-Hydroxy-2-(3-Hydroxyphenyl)Acetic Acid
- 3-Hydroxyphenylglycolic acid
- <span class="text-smallcaps">DL</span>-3-Hydroxymandelic acid
- Benzeneacetic acid, α,3-dihydroxy-
- Hydroxy(3-Hydroxyphenyl)Acetic Acid
- Mandelic acid, m-hydroxy-
- alpha,3-Dihydroxybenzeneacetic acid
- α,3-Dihydroxybenzeneacetic acid
- 3-Hydroxymandelic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Hydroxymandelic Acid
CAS:3-Hydroxymandelic Acid is a metabolite of Phenylephrine.Formula:C8H8O4Purity:98.47%Color and Shape:SolidMolecular weight:168.153-Hydroxymandelic Acid
CAS:Controlled ProductApplications 3-Hydroxymandelic Acid (cas# 17119-15-2) is a compound useful in organic synthesis.
Formula:C8H8O4Color and Shape:NeatMolecular weight:168.153-Hydroxymandelic acid
CAS:3-Hydroxymandelic acid is a metabolite of mandelic acid and has been found to have cytostatic effects in human cells. The concentration–time curve for 3-hydroxymandelic acid displays a single-dose pharmacokinetics. It has been shown to inhibit the nuclear factor kappa-light-chain enhancer (NFκB) pathway, which is involved in the regulation of cell proliferation, differentiation, and apoptosis. 3-Hydroxymandelic acid also inhibits energy metabolism by reducing mitochondrial respiration. This compound binds to plasma proteins and is excreted through urine as well as being oxidized by hepatic cytochrome P450 enzymes.Formula:C8H8O4Purity:Min. 95%Molecular weight:168.15 g/mol





