CAS 171197-80-1

2-Fluoro-5-iodopyridine

Description:

2-Fluoro-5-iodopyridine is a heterocyclic organic compound characterized by the presence of both fluorine and iodine substituents on a pyridine ring. The molecular structure consists of a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, with a fluorine atom at the 2-position and an iodine atom at the 5-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly in nucleophilic substitution reactions, due to the presence of the halogen atoms, which can influence the electronic properties of the pyridine ring. 2-Fluoro-5-iodopyridine is utilized in various applications, including medicinal chemistry and the synthesis of more complex organic molecules, owing to its ability to serve as a building block in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks and environmental hazards.

Formula: C₅H₃FIN

InChI: InChI=1/C5H3FIN/c6-5-2-1-4(7)3-8-5/h1-3H

InChI key: GYZNHUNWABYAPO-UHFFFAOYSA-N

SMILES: c1cc(F)ncc1I

2-Fluoro-5-iodopyridine

CAS: 171197-80-1

Formula: C₅H₃FIN

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 222.99

Ref: 3B-F0523

2-Fluoro-5-iodopyridine

CAS: 171197-80-1

2-Fluoro-5-iodopyridine

Formula: C₅H₃FIN

Purity: 98%

Color and Shape: Pale yellow Solid-Crystals

Molecular weight: 222.98689

Ref: 54-PC10421

2-Fluoro-5-iodopyridine

CAS: 171197-80-1

Formula: C₅H₃FIN

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.9869

Ref: IN-DA00APH6

2-Fluoro-5-iodopyridine

CAS: 171197-80-1

Formula: C₅H₃FIN

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.989

Ref: 10-F036309

2-Fluoro-5-iodopyridine

CAS: 171197-80-1

2-Fluoro-5-iodopyridine

Formula: C₅H₃FIN

Purity: 98%

Molecular weight: 222.99

Ref: IN-DG2560