CAS 171228-49-2
:Posaconazole
Description:
Posaconazole is a triazole antifungal agent primarily used for the prevention and treatment of fungal infections, particularly in immunocompromised patients. It exhibits a broad spectrum of activity against various fungi, including Candida and Aspergillus species. The chemical structure of posaconazole features a triazole ring, which is crucial for its mechanism of action, as it inhibits the enzyme lanosterol 14α-demethylase, disrupting ergosterol synthesis in fungal cell membranes. This leads to increased membrane permeability and ultimately cell death. Posaconazole is characterized by its relatively low solubility in water, which can affect its bioavailability; however, it is available in various formulations, including oral suspension and delayed-release tablets. The drug is metabolized primarily in the liver, and its pharmacokinetics can be influenced by factors such as food intake and concomitant medications. Common side effects may include gastrointestinal disturbances and liver enzyme elevations. Overall, posaconazole is a vital therapeutic option in the management of invasive fungal infections, particularly in high-risk populations.
Formula:C37H42F2N8O4
InChI:InChI=1S/C37H42F2N8O4/c1-3-35(26(2)48)47-36(49)46(25-42-47)31-7-5-29(6-8-31)43-14-16-44(17-15-43)30-9-11-32(12-10-30)50-20-27-19-37(51-21-27,22-45-24-40-23-41-45)33-13-4-28(38)18-34(33)39/h4-13,18,23-27,35,48H,3,14-17,19-22H2,1-2H3/t26-,27+,35-,37-/m0/s1
InChI key:InChIKey=RAGOYPUPXAKGKH-XAKZXMRKSA-N
SMILES:C([C@@]1(C[C@H](COC2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)N5C(=O)N([C@H]([C@H](C)O)CC)N=C5)CO1)C6=C(F)C=C(F)C=C6)N7C=NC=N7
Synonyms:- (2xi)-1,4-anhydro-2,3,5-trideoxy-4-(2,4-difluorophenyl)-2-({4-[4-(4-{1-[(2S,3S)-2-hydroxypentan-3-yl]-5-oxo-1,5-dihydro-4H-1,2,4-triazol-4-yl}phenyl)piperazin-1-yl]phenoxy}methyl)-5-(1H-1,2,4-triazol-1-yl)-D-glycero-pentitol
- 2,5-Anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2S)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-<span class="text-smallcaps">D</span>-threo-pentitol
- 2,5-Anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2S)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-D-threo-pentitol
- 4-[4-[4-[4-[[(3R,5R)-5-(2,4-Difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2S,3S)-2-hydroxypentan-3-yl]-1,2,4-triazol-3-one
- <span class="text-smallcaps">D</span>-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2S)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-
- Hydroxypropyl]-2,4-Dihydro-3H-1,2,4-Triazol-3-One
- Noxafil
- Posaconazole SP
- Posaconazole for research
- Sch 56592
- D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2S)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-
- 3H-1,2,4-Triazol-3-one, 4-[4-[4-[4-[[5-(2,4-difluorophenyl)tetrahydro-5-(1H-1,2,4-triazol-1-ylmethyl)-3-furanyl]methoxy]phenyl]-1-piperazinyl]phenyl]-2-(1-ethyl-2-hydroxypropyl)-2,4-dihydro-, [3R-[3α(1S*,2S*),5α]]-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 19 products.
Posaconazole
CAS:Formula:C37H42F2N8O4Purity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:700.79Posaconazole
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C37H42F2N8O4Color and Shape:White PowderMolecular weight:700.329714-[4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2S,3S)-2-hydroxypentan-3-yl]-1,2,4-triazol-3-one
CAS:Formula:C37H42F2N8O4Purity:98%Color and Shape:SolidMolecular weight:700.7774Ref: IN-DA0039KV
1g77.00€5g168.00€10g288.00€1kgTo inquire25g540.00€100gTo inquire500gTo inquire50mg24.00€100mg29.00€250mg44.00€Posaconazole-d5
CAS:Formula:C37H37D5F2N8O4Color and Shape:White To Off-White SolidMolecular weight:705.82Posaconazole
CAS:Formula:C37H42F2N8O4Purity:98.0 - 102.0 % (dry basis)Color and Shape:White to off-white powderMolecular weight:700.78Posaconazole
CAS:Posaconazole (POS) is a sterol C14ɑ demethylase inhibitor (IC50: 0.25 nM).Formula:C37H42F2N8O4Purity:99.72% - >99.99%Color and Shape:White SolidMolecular weight:700.78Posaconazole Impurity 92
CAS:Formula:C14H15F2N3O2Color and Shape:White To Off-White SolidMolecular weight:295.29Posaconazole - Bio-X ™
CAS:<p>Posaconazole is a triazole antifungal agent that inhibits the 14-alpha demethylase enzyme. This drug prevents the formation of fungal cell walls thus leading to fungal cell lysis. Posaconazole is shown to inflict its inhibitory activity against common pathogenic fungus such as Candida and Aspergillus species in severely immunocompromised patients.</p>Formula:C37H42F2N8O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:700.78 g/molPosaconazole - Form I
CAS:<p>Posaconazole is an antifungal agent that inhibits the 14-alpha demethylase enzyme which is responsible for the synthesis of the fungal cell wall component, ergosterol. This demethylase enzyme synthesizes ergosterol through converting lanosterol to ergosterol. Therefore Posaconazole prevents the formation of fungal cell walls with the appropriate membrane permeability thus leading to fungal cell lysis. Posaconazole can be used as an antifungal drug to treat opportunistic fungal infections in immunocompromised individuals such as HIV patients. Moreover it is shown to inflict its inhibitory activity against common pathogenic fungus such as Candida and Aspergillus species but also Mucorales and some Fusarium species, which are less common.</p>Formula:C37H42F2N8O4Purity:Min. 95%Molecular weight:700.78 g/molPosaconazole
CAS:<p>Posaconazole is an antifungal agent that inhibits the 14-alpha demethylase enzyme which is responsible for the synthesis of the fungal cell wall component, ergosterol. This demethylase enzyme synthesizes ergosterol through converting lanosterol to ergosterol. Therefore Posaconazole prevents the formation of fungal cell walls with the appropriate membrane permeability thus leading to fungal cell lysis. Posaconazole can be used as an antifungal drug to treat opportunistic fungal infections in immunocompromised individuals such as HIV patients. Moreover it is shown to inflict its inhibitory activity against common pathogenic fungus such as Candida and Aspergillus species but also Mucorales and some Fusarium species, which are less common.</p>Formula:C37H42F2N8O4Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:700.78 g/molPosaconazole - Form III
CAS:<p>Posaconazole is an antifungal agent that inhibits the 14-alpha demethylase enzyme which is responsible for the synthesis of the fungal cell wall component, ergosterol. This demethylase enzyme synthesizes ergosterol through converting lanosterol to ergosterol. Therefore Posaconazole prevents the formation of fungal cell walls with the appropriate membrane permeability thus leading to fungal cell lysis. Posaconazole can be used as an antifungal drug to treat opportunistic fungal infections in immunocompromised individuals such as HIV patients. Moreover it is shown to inflict its inhibitory activity against common pathogenic fungus such as Candida and Aspergillus species but also Mucorales and some Fusarium species, which are less common.</p>Formula:C37H42F2N8O4Purity:Min. 95%Molecular weight:700.78 g/molPosaconazole Monodesfluoro
CAS:Controlled ProductFormula:C21H22FN3O4SColor and Shape:NeatMolecular weight:431.481Posaconazole (Ethyl-d5)
CAS:Controlled ProductFormula:C37D5H37F2N8O4Color and Shape:NeatMolecular weight:705.808











