CAS 17124-82-2
:Carbamimidothioic acid, 2-(dimethylamino)ethyl ester
Description:
Carbamimidothioic acid, 2-(dimethylamino)ethyl ester, also known by its CAS number 17124-82-2, is an organic compound characterized by the presence of a carbamimidothioic acid functional group and a dimethylaminoethyl ester moiety. This compound typically exhibits properties associated with both amines and thiols, which can influence its reactivity and solubility. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the dimethylamino group suggests that it may exhibit basic properties, making it soluble in polar solvents. Additionally, the thiol component may impart characteristics such as nucleophilicity, allowing it to participate in various chemical reactions, including those involving electrophiles. This compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific uses would depend on further research and development. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C5H13N3S
InChI:InChI=1S/C5H13N3S/c1-8(2)3-4-9-5(6)7/h3-4H2,1-2H3,(H3,6,7)
InChI key:InChIKey=MUYRPUKYVOXLSN-UHFFFAOYSA-N
SMILES:C(CN(C)C)SC(=N)N
Synonyms:- 2-(Dimethylamino)ethyl carbamimidothioate
- 2-(S-Dimethylaminoethyl)isothiourea
- Carbamimidothioic acid, 2-(dimethylamino)ethyl ester
- Pseudourea, 2-(2-dimethylaminoethyl)-2-thio-
- Sk&F 91487
- Skf-91487
- [2-(Carbamimidoylsulfanyl)ethyl]dimethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nordimaprit
CAS:<p>Nordimaprit is effective agonist in the inhibition of lymphocyte activation.</p>Formula:C5H13N3SColor and Shape:SolidMolecular weight:147.24
