CAS 17126-90-8
:2-Oxoheptanedioic acid
Description:
2-Oxoheptanedioic acid, also known as 2-oxo-7-carboxyheptanoic acid, is a dicarboxylic acid characterized by its two carboxyl functional groups (-COOH) and a ketone group (C=O) located at the second carbon of a seven-carbon chain. This compound typically appears as a white to off-white solid and is soluble in water and organic solvents, which is common for many dicarboxylic acids. Its molecular structure allows it to participate in various chemical reactions, including esterification and decarboxylation. The presence of both carboxylic acid and ketone functionalities makes it a versatile intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 2-oxoheptanedioic acid can serve as a building block for the synthesis of more complex molecules. Its reactivity and functional groups also suggest potential applications in biochemistry, particularly in metabolic pathways involving fatty acids and amino acids. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H10O5
InChI:InChI=1S/C7H10O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-4H2,(H,9,10)(H,11,12)
InChI key:InChIKey=HABHUTWTLGRDDU-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)C(C(O)=O)=O
Synonyms:- Heptanedioic acid, 2-oxo-
- α-Ketopimelic acid
- 2-Oxoheptanedioic acid
- 2-Oxopimelic acid
- α-Oxopimelic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Ketopimelic acid
CAS:2-Ketopimelic acid is a fatty acid that is produced by the catalysis of 2-ketoglutarate. It is found in the mitochondrial matrix and in the biosynthesis of fatty acids. The wild-type strain of E. coli has been shown to produce 2-ketopimelic acid during aerobic growth on glucose, while mutant strains did not synthesize this compound. The production of 2-ketopimelic acid requires a functional acyl carrier protein (ACP) and an active enoyl reductase (ER). The biosynthesis of 2-ketopimelic acid can be catalysed by dehydrogenase enzymes such as enoyl reductase, which are involved in the conversion of 3-oxoacyl CoA into 3-hydroxyacyl CoA. 2-Ketopimelic acid may also play a role in tuberculosis, as it has been detected in human protein using reaction monitoring techniquesFormula:C7H10O5Purity:Min. 95%Color and Shape:PowderMolecular weight:174.15 g/mol
