CymitQuimica logo

CAS 171277-87-5

:

N-(2,6-Difluorophenyl)hydrazinecarboxamide

Description:
N-(2,6-Difluorophenyl)hydrazinecarboxamide is a chemical compound characterized by its hydrazine and carboxamide functional groups, along with a difluorophenyl substituent. This compound typically exhibits properties associated with both hydrazines and amides, such as potential reactivity due to the presence of the hydrazine moiety, which can participate in various chemical reactions, including condensation and oxidation. The difluorophenyl group contributes to its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of fluorine atoms can enhance the compound's metabolic stability and alter its pharmacokinetic properties. Additionally, this compound may exhibit specific solubility characteristics in organic solvents, depending on its molecular structure. Its CAS number, 171277-87-5, allows for precise identification in chemical databases and literature. Overall, N-(2,6-Difluorophenyl)hydrazinecarboxamide is a compound of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features and potential applications.
Formula:C7H7F2N3O
InChI:InChI=1S/C7H7F2N3O/c8-4-2-1-3-5(9)6(4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13)
InChI key:InChIKey=ZLGBXPZEBAXBAD-UHFFFAOYSA-N
SMILES:N(C(NN)=O)C1=C(F)C=CC=C1F
Synonyms:
  • 1-Amino-3-(2,6-difluorophenyl)urea
  • N-(2,6-Difluorophenyl)hydrazinecarboxamide
  • 3-Amino-1-(2,6-difluorophenyl)urea
  • Hydrazinecarboxamide, N-(2,6-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.