CAS 17131-52-1
:3-(4-Methoxyphenoxy)-1,2-propanediol
Description:
3-(4-Methoxyphenoxy)-1,2-propanediol, with the CAS number 17131-52-1, is an organic compound characterized by its structure, which includes a propanediol backbone substituted with a methoxyphenoxy group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents and exhibits moderate solubility in water, which is influenced by the presence of the hydroxyl groups. The methoxy group contributes to its hydrophobic characteristics, while the hydroxyl groups enhance its potential for hydrogen bonding. This compound is often studied for its applications in pharmaceuticals, cosmetics, and as a potential intermediate in organic synthesis. Its chemical properties may include moderate reactivity, particularly in reactions involving the hydroxyl groups, making it useful in various chemical transformations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H14O4
InChI:InChI=1S/C10H14O4/c1-13-9-2-4-10(5-3-9)14-7-8(12)6-11/h2-5,8,11-12H,6-7H2,1H3
InChI key:InChIKey=UWZDUHTYIUMENV-UHFFFAOYSA-N
SMILES:O(CC(CO)O)C1=CC=C(OC)C=C1
Synonyms:- 1,2-Propanediol, 3-(4-methoxyphenoxy)-
- 1,2-Propanediol, 3-(p-methoxyphenoxy)-
- 3-(4-Methoxyphenoxy)propane-1,2-diol
- 3-(4′-Methoxyphenoxy)-1,2-dihydroxypropane
- 3-(p-Methoxyphenoxy)-1,2-propanediol
- Brn 2099432
- Nsc 113106
- Rac-3-(4-Methoxyphenoxy)propane-1,2-diol
- 3-(4-Methoxyphenoxy)-1,2-propanediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(4-Methoxyphenoxy)propane-1,2-diol
CAS:Formula:C10H14O4Color and Shape:SolidMolecular weight:198.21583-(4-Methoxyphenoxy)-1,2-propanediol
CAS:3-(4-Methoxyphenoxy)-1,2-propanediol is a chiral molecule that can be found in various products. It has been used in the synthesis of a variety of drugs and other organic compounds. 3-(4-Methoxyphenoxy)-1,2-propanediol is an intermediate for the synthesis of natural products such as benzofuran and benzothiophene. This compound is also used as a reagent in the asymmetric dihydroxylation of epoxides. The rate at which this reaction proceeds depends on the kinetic parameters, such as the concentration of reactant and transition state analogues, and on the reaction conditions, such as temperature and pH. The product of this reaction is an epoxide hydrolase inhibitor with a reactive anion that can be used to synthesize pharmaceuticals.
Formula:C10H14O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:198.22 g/mol

