CAS 1713160-58-7

1-Chloro-3-(propylthio)benzene

Description:

1-Chloro-3-(propylthio)benzene is an organic compound characterized by the presence of a chlorine atom and a propylthio group attached to a benzene ring. The chlorine atom is located at the first position, while the propylthio group is positioned at the third carbon of the aromatic ring, indicating a specific substitution pattern. This compound is typically a colorless to pale yellow liquid with a distinct odor, reflecting its aromatic nature. It is soluble in organic solvents but has limited solubility in water due to the hydrophobic characteristics of the benzene ring and the propylthio group. The presence of the chlorine atom introduces reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitution reactions. Additionally, the propylthio group can influence the compound's physical and chemical properties, including its boiling point and reactivity. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₉H₁₁ClS

InChI: InChI=1S/C9H11ClS/c1-2-6-11-9-5-3-4-8(10)7-9/h3-5,7H,2,6H2,1H3

InChI key: InChIKey=BCYBNWJILXCCIF-UHFFFAOYSA-N

SMILES: S(CCC)C1=CC(Cl)=CC=C1

Synonyms:

• Benzene, 1-chloro-3-(propylthio)-
• 1-Chloro-3-(propylthio)benzene

m-Chlorophenyl propyl sulfide

CAS: 1713160-58-7

Formula: C₉H₁₁ClS

Molecular weight: 186.7

Ref: 10-F095027