CymitQuimica logo

CAS 1713160-59-8

:

Benzene, 1-methyl-3-[(3,3,3-trifluoropropyl)thio]-

Description:
Benzene, 1-methyl-3-[(3,3,3-trifluoropropyl)thio]- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a methyl group and a thioether group containing a trifluoropropyl moiety. The presence of the trifluoropropyl group imparts unique properties, such as increased hydrophobicity and potential volatility, due to the fluorine atoms. This compound may exhibit interesting chemical reactivity, particularly in nucleophilic substitution reactions, owing to the electron-withdrawing nature of the trifluoropropyl group. Additionally, the thioether linkage can influence the compound's solubility and interaction with other chemical species. The compound's physical properties, such as boiling point and melting point, are influenced by its molecular structure and the presence of fluorine, which can enhance stability and alter intermolecular forces. As with many fluorinated compounds, it may also exhibit unique environmental and biological behavior, necessitating careful handling and assessment of its safety profile. Overall, this compound represents a specialized class of organofluorine compounds with potential applications in various fields, including materials science and pharmaceuticals.
Formula:C10H11F3S
InChI:InChI=1S/C10H11F3S/c1-8-3-2-4-9(7-8)14-6-5-10(11,12)13/h2-4,7H,5-6H2,1H3
InChI key:InChIKey=ZYZJYDNRULWIQA-UHFFFAOYSA-N
SMILES:S(CCC(F)(F)F)C1=CC(C)=CC=C1
Synonyms:
  • Benzene, 1-methyl-3-[(3,3,3-trifluoropropyl)thio]-
  • 1-Methyl-3-[(3,3,3-trifluoropropyl)thio]benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.