CAS 1713160-69-0

4-Pyrimidinamine, 6-methoxy-N-4-piperidinyl-, hydrochloride (1:2)

Description:

4-Pyrimidinamine, 6-methoxy-N-4-piperidinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a methoxy group at the 6-position and a piperidine moiety attached to the nitrogen at the 4-position, contributing to its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit various biological activities, including potential effects on the central nervous system or other physiological pathways. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₀H₁₆N₄O·2ClH

InChI: InChI=1S/C10H16N4O.2ClH/c1-15-10-6-9(12-7-13-10)14-8-2-4-11-5-3-8;;/h6-8,11H,2-5H2,1H3,(H,12,13,14);2*1H

InChI key: InChIKey=IXRTUZVIUUTPAX-UHFFFAOYSA-N

SMILES: N(C=1C=C(OC)N=CN1)C2CCNCC2.Cl

Synonyms:

• 4-Pyrimidinamine, 6-methoxy-N-4-piperidinyl-, hydrochloride (1:2)

6-Methoxy-N-(piperidin-4-yl)pyrimidin-4-amine dihydrochloride

CAS: 1713160-69-0

Formula: C₁₀H₁₈Cl₂N₄O

Molecular weight: 281.18

Ref: 10-F096193