CAS 1713163-23-5

2H-Thiopyran-4-carboxylic acid, tetrahydro-4-methyl-, 1,1-dioxide

Description:

2H-Thiopyran-4-carboxylic acid, tetrahydro-4-methyl-, 1,1-dioxide, identified by its CAS number 1713163-23-5, is a heterocyclic compound featuring a thiopyran ring structure. This compound contains a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the tetrahydro and methyl substituents indicates that it has a saturated structure, which may influence its physical properties such as solubility and boiling point. The 1,1-dioxide designation suggests that it has two oxygen atoms double-bonded to the sulfur atom in the thiopyran ring, enhancing its reactivity and possibly its biological activity. Such compounds are often of interest in medicinal chemistry and materials science due to their unique structural features and potential applications. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and pharmaceutical contexts.

Formula: C₇H₁₂O₄S

InChI: InChI=1S/C7H12O4S/c1-7(6(8)9)2-4-12(10,11)5-3-7/h2-5H2,1H3,(H,8,9)

InChI key: InChIKey=ATQHGENFZNCQDE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(C)CCS(=O)(=O)CC1

Synonyms:

• 2H-Thiopyran-4-carboxylic acid, tetrahydro-4-methyl-, 1,1-dioxide
• 4-Methyl-1,1-dioxo-1lambda(6)-thiane-4-carboxylic acid
• 4-Methyltetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide

Tetrahydro-​4-​methyl-2H-​thiopyran-​4-​carboxylic acid 1,​1-​dioxide

CAS: 1713163-23-5

Tetrahydro-4-methyl-2H-thiopyran-4-carboxylic acid 1,1-dioxide (THTPD) is a useful scaffold that can be used as a building block in organic synthesis. It is also a versatile intermediate and research chemical that can be used as a reaction component in the synthesis of complex compounds. THTPD has been shown to have high purity and quality. Tetrahydro-4-methyl-2H-thiopyran-4-carboxylic acid 1,1 - dioxide can be used as a reagent for the preparation of other compounds. CAS No.: 1713163-23-5.

Formula: C₇H₁₂O₄S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 192.24 g/mol

Ref: 3D-NTC16323