CAS 17132-48-8

(2S,3S)-2,3-dihydroxy-2-(propan-2-yl)butanoic acid

Description:

(2S,3S)-2,3-dihydroxy-2-(propan-2-yl)butanoic acid, also known as a derivative of a sugar acid, exhibits several notable characteristics. This compound features a chiral center, which contributes to its stereochemistry, specifically the (2S,3S) configuration. It contains two hydroxyl (-OH) groups, which enhance its solubility in water and contribute to its reactivity, particularly in forming esters or ethers. The presence of the propan-2-yl group (isopropyl) adds hydrophobic characteristics, influencing its interactions in biological systems. As a carboxylic acid, it possesses acidic properties, allowing it to participate in acid-base reactions. This compound is of interest in various fields, including biochemistry and pharmaceuticals, due to its potential role in metabolic pathways and as a building block for more complex molecules. Its specific applications may vary, but it is often studied for its biological activity and potential therapeutic uses. Overall, the unique combination of functional groups and stereochemistry makes it a compound of interest in chemical research and applications.

Formula: C₇H₁₄O₄

InChI: InChI=1/C7H14O4/c1-4(2)7(11,5(3)8)6(9)10/h4-5,8,11H,1-3H3,(H,9,10)/t5-,7-/m0/s1

SMILES: CC(C)[C@]([C@H](C)O)(C(=O)O)O

(2S,3S)-Viridifloric Acid

Controlled Product

CAS: 17132-48-8

Formula: C₇H₁₄O₄

Color and Shape: Neat

Molecular weight: 162.184

Ref: TR-V673895