CymitQuimica logo

CAS 17133-95-8

:

2-Ethyl-5-methylbenzofuran

Description:
2-Ethyl-5-methylbenzofuran is an organic compound characterized by its fused benzene and furan rings, which contribute to its aromatic properties. It features an ethyl group and a methyl group attached to the benzofuran structure, influencing its chemical reactivity and physical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is relatively hydrophobic, indicating low solubility in water but higher solubility in organic solvents. The presence of the ethyl and methyl substituents can affect its boiling point, melting point, and density compared to other benzofuran derivatives. 2-Ethyl-5-methylbenzofuran may exhibit interesting biological activities, making it a subject of interest in various fields, including medicinal chemistry and materials science. Its CAS number, 17133-95-8, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C11H12O
InChI:InChI=1S/C11H12O/c1-3-10-7-9-6-8(2)4-5-11(9)12-10/h4-7H,3H2,1-2H3
InChI key:InChIKey=GQHVHQOJJFDUKW-UHFFFAOYSA-N
SMILES:C(C)C=1OC=2C(C1)=CC(C)=CC2
Synonyms:
  • 2-Ethyl-5-Methyl-1-Benzofuran
  • Benzofuran, 2-ethyl-5-methyl-
  • 2-Ethyl-5-methylbenzofuran
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.