CAS 17135-47-6

7-Chloro-1-(4-fluorophenyl)-1-heptanone

Description:

7-Chloro-1-(4-fluorophenyl)-1-heptanone, with the CAS number 17135-47-6, is an organic compound characterized by its ketone functional group and the presence of both chlorine and fluorine substituents. This compound features a heptanone backbone, indicating a seven-carbon chain with a ketone functional group at the first position. The chlorine atom is located at the seventh carbon, while a para-fluorophenyl group is attached to the first carbon, contributing to its unique chemical properties. The presence of halogens (chlorine and fluorine) can influence the compound's reactivity, polarity, and potential biological activity. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the molecular structure suggests potential applications in various fields, including agrochemicals and materials science. As with many organic compounds, the specific characteristics such as solubility, melting point, and boiling point would depend on the molecular interactions and the environment in which the substance is studied.

Formula: C₁₃H₁₆ClFO

InChI: InChI=1S/C13H16ClFO/c14-10-4-2-1-3-5-13(16)11-6-8-12(15)9-7-11/h6-9H,1-5,10H2

InChI key: InChIKey=CIIVWKNBUBKCJA-UHFFFAOYSA-N

SMILES: C(CCCCCCCl)(=O)C1=CC=C(F)C=C1

Synonyms:

• 1-Heptanone, 7-chloro-1-(4-fluorophenyl)-
• 7-Chloro-1-(4-fluorophenyl)-1-heptanone
• Heptanophenone, 7-chloro-4′-fluoro-

Haloperidol Impurity 15

CAS: 17135-47-6

Formula: C₁₃H₁₆ClFO

Molecular weight: 242.72

Ref: 4Z-H-0148

7-Chloro-1-(4-fluorophenyl)-1-heptanone

Controlled Product

CAS: 17135-47-6

Formula: C₁₃H₁₆ClFO

Color and Shape: Neat

Molecular weight: 242.717

Ref: TR-C171020