CAS 17142-81-3
:6-Benzothiazolamine,2-ethyl-(9CI)
Description:
6-Benzothiazolamine, 2-ethyl- (9CI), with the CAS number 17142-81-3, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features an amino group (-NH2) at the 6-position and an ethyl group at the 2-position of the benzothiazole moiety. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group suggests potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility as a building block in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C9H10N2S
InChI:InChI=1/C9H10N2S/c1-2-9-11-7-4-3-6(10)5-8(7)12-9/h3-5H,2,10H2,1H3
SMILES:CCc1nc2ccc(cc2s1)N
Synonyms:- 2-Ethyl-1,3-benzothiazol-6-amine
- 6-Benzothiazolamine, 2-Ethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Amino-2-ethyl-1,3-benzothiazole
CAS:6-Amino-2-ethyl-1,3-benzothiazoleFormula:C9H10N2SPurity:≥95%Color and Shape: brown solidMolecular weight:178.25g/mol2-Ethyl-6-benzothiazolamine
CAS:Controlled ProductFormula:C9H10N2SColor and Shape:NeatMolecular weight:178.2542-Ethyl-6-benzothiazolamine
CAS:2-Ethyl-6-benzothiazolamine is a quaternary ammonium salt that is synthesized from 2-ethyl-6-nitrobenzothiazole by reaction with methyl methacrylate. It has a number of photochromic properties, including the ability to undergo reversible color changes in response to light irradiation. This compound can be used to synthesize methacrylic chloride copolymers, which are used in the manufacture of paints and coatings. 2-Ethyl-6-benzothiazolamine has been shown to have nitro and chloride functionalities, which may make it useful as an explosive ingredient.
Formula:C9H10N2SPurity:Min. 95%Molecular weight:178.25 g/mol




