CymitQuimica logo

CAS 171426-13-4

:

2-Bromo-5-fluoro-N-methylBenzamide

Description:
2-Bromo-5-fluoro-N-methylbenzamide is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH) group. The specific structure includes a bromine atom at the second position and a fluorine atom at the fifth position of the benzene ring, along with a methyl group attached to the nitrogen of the amide. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique halogen substituents can influence its reactivity and biological activity, making it of interest in medicinal chemistry and material science. The presence of both bromine and fluorine can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interactions with biological targets. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C8H7BrFNO
InChI:InChI=1S/C8H7BrFNO/c1-11-8(12)6-4-5(10)2-3-7(6)9/h2-4H,1H3,(H,11,12)
InChI key:HITYBKUDPXVEEO-UHFFFAOYSA-N
SMILES:CNC(=O)C1=C(C=CC(=C1)F)Br
Synonyms:
  • 2-Bromo-5-fluoro-N-methylbenzamide 98%
  • 2-Bromo-5-fluoro-N-methylbenzamide98%
  • N-Methyl 2-bromo-5-fluorobenzamide
Found 3 products.