CAS 17145-91-4
:triethyl 2-phosphonobutyrate
Description:
Triethyl 2-phosphonobutyrate, with the CAS number 17145-91-4, is an organophosphorus compound characterized by its phosphonate functional group. It typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, making it useful in various chemical applications. The compound features a butyrate moiety, which contributes to its ester characteristics, and the presence of three ethyl groups enhances its lipophilicity. Triethyl 2-phosphonobutyrate is often utilized in organic synthesis, particularly in the preparation of phosphonates and as a reagent in the formation of carbon-phosphorus bonds. Additionally, it may exhibit biological activity, which has led to its investigation in the context of agrochemicals and pharmaceuticals. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage and handling protocols are essential to mitigate risks associated with exposure.
Formula:C10H21O5P
InChI:InChI=1/C10H21O5P/c1-5-9(10(11)13-6-2)16(12,14-7-3)15-8-4/h9H,5-8H2,1-4H3/t9-/m0/s1
SMILES:CC[C@@H](C(=O)OCC)P(=O)(OCC)OCC
Synonyms:- Diethyl 1-(ethoxycarbonyl)propanephosphonate~2-Phosphonobutyric acid triethyl ester
- Triethyl2-phosphonobutyrate
- Ethyl 2-(Diethoxyphosphoryl)Butanoate
- ethyl (2R)-2-(diethoxyphosphoryl)butanoate
- ethyl (2S)-2-(diethoxyphosphoryl)butanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Triethyl 2-phosphonobutyrate, 97%
CAS:Reactant used for preparation of furospinosulin-1 and analogs as hypoxia-selective antitumor agents, Aminoquinolines as beta-site amyloid precursor protein cleaving enzyme 1 (BACE1) inhibitors and potential anti-Alzheimer?s drugs, phenylpropanoic acid peroxisome proliferator-activated receptor (PPARFormula:C10H21O5PPurity:97%Color and Shape:Liquid, Clear colorlessMolecular weight:252.25Ethyl 2-(diethoxyphosphoryl)butanoate
CAS:Formula:C10H21O5PPurity:97%Color and Shape:LiquidMolecular weight:252.2445Triethyl 2-phosphonobutyrate
CAS:Triethyl 2-phosphonobutyrateFormula:C10H21O5PPurity:98%Color and Shape: clear. colourless liquidMolecular weight:252.24g/mol



