CAS 17147-42-1
:Ethyl 3,5-dimethylisoxazole-4-carboxylate
Description:
Ethyl 3,5-dimethylisoxazole-4-carboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features two methyl groups at the 3 and 5 positions of the isoxazole ring, contributing to its unique properties and reactivity. The presence of the ethyl ester group at the 4-position enhances its solubility in organic solvents and may influence its biological activity. Ethyl 3,5-dimethylisoxazole-4-carboxylate is often utilized in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its structure allows for various functionalization reactions, making it a versatile building block in synthetic chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the isoxazole ring, which can be critical in designing compounds with specific biological activities or chemical properties.
Formula:C8H11NO3
InChI:InChI=1/C8H11NO3/c1-4-11-8(10)7-5(2)9-12-6(7)3/h4H2,1-3H3
SMILES:CCOC(=O)c1c(C)noc1C
Synonyms:- Ethyl 3,5-Dimethyl-1,2-Oxazole-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 3,5-Dimethylisoxazole-4-carboxylate
CAS:Formula:C8H11NO3Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:169.18Ethyl 3,5-dimethylisoxazole-4-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H11NO3Purity:97%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:169.18Ethyl 3,5-dimethylisoxazole-4-carboxylate
CAS:Formula:C8H11NO3Purity:95%Color and Shape:LiquidMolecular weight:169.1778Ethyl 3,5-dimethylisoxazole-4-carboxylate
CAS:Ethyl 3,5-dimethylisoxazole-4-carboxylateFormula:C8H11NO3Purity:≥95%Color and Shape: clear. faint yellow liquidMolecular weight:169.18g/mol3,5-Dimethyl-isoxazole-4-carboxylic acid ethyl ester
CAS:Formula:C8H11NO3Purity:97.0%Color and Shape:Liquid, ClearMolecular weight:169.18




