CAS 17147-85-2
:3-ETHYL-5-METHYLISOXAZOLE-4-CARBOXYLIC ACID
Description:
3-Ethyl-5-methylisoxazole-4-carboxylic acid is a heterocyclic organic compound characterized by its isoxazole ring structure, which consists of a five-membered ring containing both nitrogen and oxygen atoms. This compound features an ethyl group and a methyl group as substituents on the isoxazole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its solubility and reactivity can be influenced by the substituents on the isoxazole ring, making it an interesting subject for studies related to medicinal chemistry. Additionally, the compound's molecular structure allows for various synthetic modifications, which can lead to the development of derivatives with enhanced properties. Overall, 3-ethyl-5-methylisoxazole-4-carboxylic acid is notable for its structural features and potential applications in drug discovery.
Formula:C7H9NO3
InChI:InChI=1/C7H9NO3/c1-3-5-6(7(9)10)4(2)11-8-5/h3H2,1-2H3,(H,9,10)
SMILES:CCc1c(c(C)on1)C(=O)O
Synonyms:- 3-Ethyl-5-Methyl-4-Isoxazolecarboxylic Acid
- Akos Pao-1631
- Akos B013953
- 5-Methyl-3-Ethylisoxazole-4-Carboxylic Acid
- Chembrdg-Bb 4004641
- Buttpark 154\06-46
- Art-Chem-Bb B013953
- 3-Ethyl-5-Methyl-1,2-Oxazole-4-Carboxylate
- 3-Ethyl-5-Methyl-1,2-Oxazole-4-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Ethyl-5-methylisoxazole-4-carboxylic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H8NO3Purity:97%Color and Shape:White to cream, PowderMolecular weight:154.153-Ethyl-5-methylisoxazole-4-carboxylic acid
CAS:Formula:C7H9NO3Purity:97%Color and Shape:SolidMolecular weight:155.15135-Methyl-3-ethylisoxazole-4-carboxylic acid
CAS:<p>5-Methyl-3-ethylisoxazole-4-carboxylic acid</p>Purity:≥95%Molecular weight:155.15g/mol



