CAS 17151-09-6

1,2-BIS(TRIMETHYLSILYL)BENZENE

Description:

1,2-Bis(trimethylsilyl)benzene is an organosilicon compound characterized by the presence of two trimethylsilyl groups attached to a benzene ring at the 1 and 2 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its hydrophobic properties due to the presence of the trimethylsilyl groups, which enhance its stability and solubility in organic solvents while making it less soluble in water. The compound is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the field of polymer chemistry and materials science. Its structure contributes to its ability to act as a protecting group for functional groups in organic synthesis. Additionally, 1,2-bis(trimethylsilyl)benzene may exhibit thermal stability and resistance to oxidation, making it useful in high-temperature applications. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₁₂H₂₂Si₂

InChI: InChI=1/C12H22Si2/c1-13(2,3)11-9-7-8-10-12(11)14(4,5)6/h7-10H,1-6H3

SMILES: C[Si](C)(C)c1ccccc1[Si](C)(C)C

Synonyms:

• 1,2-Bis(Trimethylsily)Benzene
• 1,2-Bis(Trimethylsilyl)Benzene 98%
• Benzene-1,2-Diylbis(Trimethylsilane)

1,2-Bis(trimethylsilyl)benzene

CAS: 17151-09-6

Formula: C₁₂H₂₂Si₂

Purity: >95.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 222.48

Ref: 3B-B2299

1,2-Bis(trimethylsilyl)benzene

CAS: 17151-09-6

Formula: C₁₂H₂₂Si₂

Purity: 95%

Molecular weight: 222.4741

Ref: IN-DA003DCS

1,2-Bis(Trimethylsilyl)Benzene

CAS: 17151-09-6

1,2-Bis(Trimethylsilyl)Benzene

Purity: 95%

Molecular weight: 222.48g/mol

Ref: 54-OR1024000

1,2-Bis(trimethylsilyl)benzene

CAS: 17151-09-6

Purity: 95%+(GC-MS);RG

Molecular weight: 222.4779968

Ref: 10-F733402