
CAS 17151-47-2
:tributyl(4-fluorophenyl)stannane
Description:
Tributyl(4-fluorophenyl)stannane, with the CAS number 17151-47-2, is an organotin compound characterized by the presence of a tin atom bonded to three butyl groups and one 4-fluorophenyl group. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively low volatility. It is soluble in organic solvents, making it useful in various chemical applications. The presence of the fluorophenyl group can impart unique electronic properties, enhancing its reactivity in certain chemical reactions, particularly in organometallic chemistry. Organotin compounds like tributyl(4-fluorophenyl)stannane are often utilized as intermediates in organic synthesis, including the preparation of pharmaceuticals and agrochemicals. However, it is important to note that organotin compounds can be toxic and pose environmental risks, leading to regulatory scrutiny regarding their use and disposal. Proper handling and safety measures are essential when working with this substance in laboratory or industrial settings.
Formula:C18H31FSn
InChI:InChI=1/C6H4F.3C4H9.Sn/c7-6-4-2-1-3-5-6;3*1-3-4-2;/h2-5H;3*1,3-4H2,2H3;/rC18H31FSn/c1-4-7-14-20(15-8-5-2,16-9-6-3)18-12-10-17(19)11-13-18/h10-13H,4-9,14-16H2,1-3H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1ccc(cc1)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Fluoro-4-(tributylstannyl)benzene
CAS:1-Fluoro-4-(tributylstannyl)benzene
Formula:C18H31FSnPurity:90+%Color and Shape: clear. colourless liquidMolecular weight:385.15g/molTributyl(4-fluorophenyl)stannane
CAS:Controlled ProductTributyl (4-fluorophenyl)stannane is a model system for the study of electrochemical properties. It is a synthetic compound that has been studied by means of both quantum mechanical calculations and experimental measurements. The electronic structure of tributyl (4-fluorophenyl)stannane in nature has been rationalized using the functional theory. The time-dependent theory has also been used to help explain cyclic phenomena, such as catalysis, by considering moieties and photophysical transitions. Tributyl (4-fluorophenyl)stannane is homoleptic, meaning it has the same number of electrons on each atom. This makes it easier to predict how tributyl (4-fluorophenyl)stannane will react with other molecules because all its bonds are identical.Formula:C18H31FSnPurity:Min. 95%Molecular weight:385.15 g/mol

