CAS 17153-20-7
:3-Methylisoxazole-4-carboxylic acid
Description:
3-Methylisoxazole-4-carboxylic acid is an organic compound characterized by its isoxazole ring structure, which features a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. The presence of a carboxylic acid functional group (-COOH) at the 4-position and a methyl group (-CH3) at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. 3-Methylisoxazole-4-carboxylic acid is of interest in medicinal chemistry and may serve as a building block for the synthesis of pharmaceuticals or agrochemicals. Its biological activity and potential applications are subjects of ongoing research, making it a compound of interest in both academic and industrial settings.
Formula:C5H5NO3
InChI:InChI=1/C5H5NO3/c1-3-4(5(7)8)2-9-6-3/h2H,1H3,(H,7,8)
SMILES:Cc1c(con1)C(=O)O
Synonyms:- 3-Methyl-4-isoxazolecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Methylisoxazole-4-carboxylic acid, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H5NO3Purity:98+%Color and Shape:White to cream or pale yellow or pale pink, Crystals or powder or crystalline powderMolecular weight:127.103-Methylisoxazole-4-carboxylic acid
CAS:Formula:C5H5NO3Purity:98%Color and Shape:SolidMolecular weight:127.0981Ref: IN-DA0033RD
1g62.00€5g166.00€10g223.00€25g680.00€100gTo inquire500gTo inquire100mg24.00€250mg25.00€3-Methylisoxazole-4-carboxylic acid
CAS:3-Methylisoxazole-4-carboxylic acidFormula:C5H5NO3Purity:≥95%Color and Shape: faint orange powderMolecular weight:127.0981g/mol3-Methylisoxazole-4-carboxylic acid
CAS:Formula:C5H5NO3Purity:98%Color and Shape:SolidMolecular weight:127.099Methylisoxazole-4-carboxylic acid
CAS:Methylisoxazole-4-carboxylic acid is an amide that is oxidized to form a hydroxycrotonic acid. It is found in food products, such as milk and eggs, which are rich in amino acids. Methylisoxazole-4-carboxylic acid can be converted to the corresponding hydroxycrotonic acid by deamination of alpha-ketoglutarate or by enamine formation with other amines. These processes are important for the metabolism of amino acids and the synthesis of proteins. Methylisoxazole-4-carboxylic acid has analgesic properties and has been shown to reduce cycloaddition reactions that lead to the formation of free radicals. The methyl group on this compound also allows it to act as a reducing agent, forming nitro compounds with nitrous oxide or nitric oxide and hydroxyl groups with alcohols, phenols, and pyridines.Formula:C5H5NO3Purity:Min. 95%Molecular weight:127.1 g/mol






