CAS 1715912-85-8

4-Bromo-6-fluoro-1H-indazol-3-amine

Description:

4-Bromo-6-fluoro-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of bromine and fluorine substituents at the 4 and 6 positions, respectively, contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its amine functional group at the 3-position can participate in hydrogen bonding, influencing its interactions in biological systems. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a scaffold for drug design. Additionally, the presence of halogens can enhance lipophilicity and alter the compound's pharmacokinetic properties. As with many indazole derivatives, it may exhibit various biological activities, including anti-cancer or anti-inflammatory effects, making it a subject of research in the field of drug discovery.

Formula: C₇H₅BrFN₃

InChI: InChI=1S/C7H5BrFN3/c8-4-1-3(9)2-5-6(4)7(10)12-11-5/h1-2H,(H3,10,11,12)

InChI key: InChIKey=UNCJKLMJNRTBKA-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(F)=C1)NN=C2N

Synonyms:

• 1H-Indazol-3-amine, 4-bromo-6-fluoro-
• 4-Bromo-6-fluoro-1H-indazol-3-amine