CAS 1717-59-5
:2-(Fluorosulfonyl)difluoroacetic acid
Description:
2-(Fluorosulfonyl)difluoroacetic acid, with the CAS number 1717-59-5, is a fluorinated organic compound characterized by the presence of both a fluorosulfonyl group and a difluoroacetic acid moiety. This compound typically exhibits high reactivity due to the presence of the electronegative fluorine atoms and the sulfonyl group, which can influence its chemical behavior and interactions. It is a colorless to pale yellow liquid at room temperature and is soluble in polar solvents. The compound is known for its strong acidity, attributed to the carboxylic acid functional group, and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Its unique structure makes it valuable in synthetic chemistry, particularly in the development of fluorinated pharmaceuticals and agrochemicals. However, due to its reactivity and potential environmental impact, handling requires caution, and appropriate safety measures should be observed.
Formula:C2HF3O4S
InChI:InChI=1/C2HF3O4S/c3-2(4,1(6)7)10(5,8)9/h(H,6,7)
SMILES:C(=O)(C(F)(F)S(=O)(=O)F)O
Synonyms:- 2-(Fluorosulphonyl)Difluoroacetic Acid
- 2,2-Difluoro-2-(Fluorosulfonyl)Acetate
- 2,2-Difluoro-2-(Fluorosulfonyl)Acetic Acid
- 4,4-Bis(Trifluoromethyl)Oxetan-2-One
- Difluoro(Fluorosulfonyl)Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2-Difluoro-2-(fluorosulfonyl)acetic Acid
CAS:Formula:C2HF3O4SPurity:>95.0%(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:178.08Difluoro(fluorosulphonyl)acetic acid
CAS:<p>Difluoro(fluorosulphonyl)acetic acid</p>Formula:C2HF3O4SPurity:98%Color and Shape: colourless liquidMolecular weight:178.08714g/mol2,2-Difluoro-2-(fluorosulfonyl)acetic Acid
CAS:Controlled Product<p>Applications An important reagent in the synthesis of difluorocarbenes and difluorocyclopropanes.<br>References Tian, F. et al.: Org. Let., 2, 563 (2000); Dolbier, W.R. et al.: J. Fluor. Chem. 125, 459 (2004)<br></p>Formula:C2HF3O4SColor and Shape:NeatMolecular weight:178.0872-Fluorosulfonyldifluoroacetic acid
CAS:Purity:98.0%Color and Shape:LiquidMolecular weight:178.08000183105472,2-Difluoro-2-(fluorosulfonyl)acetic acid
CAS:Formula:C2HF3O4SColor and Shape:LiquidMolecular weight:178.0871





