CAS 171721-03-2

1-(3,5-Di-O-benzoyl-2-deoxy-2-fluoro-β-L-arabinofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione

Description:

1-(3,5-Di-O-benzoyl-2-deoxy-2-fluoro-β-L-arabinofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione, with CAS number 171721-03-2, is a synthetic nucleoside analog characterized by its complex structure, which includes a pyrimidinedione core and a modified sugar moiety. The presence of the 2-deoxy-2-fluoro modification enhances its stability and potential bioactivity, making it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The benzoyl groups serve as protective groups for the hydroxyl functionalities, influencing solubility and reactivity. This compound typically exhibits properties such as moderate to high lipophilicity due to the aromatic benzoyl substituents, which can affect its pharmacokinetics. Additionally, its structural features may allow for specific interactions with biological targets, potentially leading to inhibition of nucleic acid synthesis. Overall, this compound represents a class of modified nucleosides that are valuable in the development of therapeutic agents.

Formula: C₂₄H₂₁FN₂O₇

InChI: InChI=1S/C24H21FN2O7/c1-14-12-27(24(31)26-20(14)28)21-18(25)19(34-23(30)16-10-6-3-7-11-16)17(33-21)13-32-22(29)15-8-4-2-5-9-15/h2-12,17-19,21H,13H2,1H3,(H,26,28,31)/t17-,18+,19-,21-/m0/s1

InChI key: InChIKey=CEPDPXNYCRCFRV-JTJHWIPRSA-N

SMILES: F[C@H]1[C@H](O[C@@H](COC(=O)C2=CC=CC=C2)[C@@H]1OC(=O)C3=CC=CC=C3)N4C(=O)NC(=O)C(C)=C4

Synonyms:

• 2,4(1H,3H)-Pyrimidinedione, 1-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-β-L-arabinofuranosyl)-5-methyl-
• 1-(3,5-Di-O-benzoyl-2-deoxy-2-fluoro-β-L-arabinofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione

1-(3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-β-L-arabinofuranosyl)thymine

CAS: 171721-03-2

1-(3`,5`-Di-O-benzoyl-2`-deoxy-2`-fluoro-beta-L-arabinofuranosyl)thymine is a nucleoside analog with modifications that influence its biological activity. It contains a thymine base and 3',5'-Di-O-benzoyl groups that protect hydroxyl functionalities during chemical synthesis. This molecule also has the sugar 2'-Deoxy-2'-fluoro-β-L-arabinofuranose made up of an L-arabinose configuration and a 2'-Fluoro substitution, the latter of which enhances stability and resistance to enzymatic degradation.

Formula: C₂₄H₂₁FN₂O₇

Purity: Min. 95%

Molecular weight: 468.43 g/mol

Ref: 3D-ND182972