CAS 17174-98-0
:2-Cyanobenzamide
Description:
2-Cyanobenzamide, with the CAS number 17174-98-0, is an organic compound characterized by the presence of both a cyanide group (-CN) and an amide group (-CONH2) attached to a benzene ring. This compound typically appears as a white to off-white solid and is known for its moderate solubility in polar solvents such as water and alcohols. It exhibits a melting point that is generally in the range of typical organic compounds, indicating its solid state at room temperature. The presence of the cyano group contributes to its reactivity, making it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. Additionally, 2-Cyanobenzamide can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions, due to the functional groups present. Its properties make it a valuable intermediate in organic synthesis, particularly in the development of biologically active compounds. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H6N2O
InChI:InChI=1S/C8H6N2O/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,(H2,10,11)
InChI key:InChIKey=STQPCKPKAIRSEL-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C(N)=O)C=CC=C1
Synonyms:- Benzamide, 2-cyano-
- Benzamide, o-cyano-
- NSC 28289
- o-Cyanobenzamide
- o-Cyanobenzamide, Pract.
- 2-Cyanobenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Cyanobenzamide
CAS:<p>2-Cyanobenzamide is a corrosion inhibitor that is used in the electrochemical industry to protect metals from corrosion. It has been shown to be suitable for use as a corrosion inhibitor in salt water and other corrosive environments. 2-Cyanobenzamide has been shown to have light sensitive properties, which is why it should not be exposed to direct light or stored in dark containers. It also inhibits enzymes that are involved in the production of reactive oxygen species (ROS) such as superoxide anion and hydrogen peroxide. The reaction of 2-cyanobenzamide with aluminium, sodium sulfide, and polymeric matrices has also been studied extensively.<br>2-Cyanobenzamide can be synthesized by reacting benzoyl chloride with ammonia and cyanogen bromide. This reaction produces a mixture of mono-, di-, tri-, and tetramers of 2-cyanobenzamide. These products can then be separated using analytical methods such as</p>Formula:C8H6N2OPurity:Min. 95%Molecular weight:146.15 g/mol
