CymitQuimica logo

CAS 171764-07-1

:

(S)-2-AMINO-3,3-DIMETHYL-N-2-PYRIDYLBUTYRAMIDE

Description:
(S)-2-Amino-3,3-dimethyl-N-2-pyridylbutyramide is a chiral compound characterized by its specific stereochemistry, indicated by the (S) configuration. This substance features a butyramide backbone with a pyridine ring, contributing to its potential biological activity. The presence of the amino group and the dimethyl substituents on the carbon chain enhances its solubility and reactivity. The compound is likely to exhibit interactions with biological targets due to the pyridine moiety, which can participate in hydrogen bonding and π-π stacking interactions. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 171764-07-1, allows for easy identification in chemical databases. As with many amides, it may exhibit properties such as moderate stability under physiological conditions, but its specific reactivity and interactions would depend on the surrounding environment and the presence of other functional groups. Overall, (S)-2-amino-3,3-dimethyl-N-2-pyridylbutyramide represents a class of compounds with potential utility in various chemical and biological applications.
Formula:C11H17N3O
InChI:InChI=1S/C11H17N3O/c1-11(2,3)9(12)10(15)14-8-6-4-5-7-13-8/h4-7,9H,12H2,1-3H3,(H,13,14,15)/t9-/m1/s1
InChI key:ACNZLRUIGXMARU-SECBINFHSA-N
SMILES:CC(C)(C)[C@@H](C(=O)NC1=CC=CC=N1)N
Found 5 products.