CymitQuimica logo

CAS 171764-16-2

:

Butanamide, 2-amino-N-(2-methoxyphenyl)-3,3-dimethyl-, (S)-

Description:
Butanamide, 2-amino-N-(2-methoxyphenyl)-3,3-dimethyl-, (S)-, identified by the CAS number 171764-16-2, is a chiral organic compound characterized by its amide functional group and a complex structure that includes a butanamide backbone, an amino group, and a methoxy-substituted phenyl ring. This compound exhibits properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amine and carbonyl groups. The (S)- designation indicates its specific stereochemistry, which can influence its biological activity and interactions. The presence of the methoxy group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals where stereochemistry plays a crucial role in efficacy and safety. Its unique structure and properties make it a candidate for further research in various chemical and biological applications.
Formula:C13H20N2O2
InChI:InChI=1S/C13H20N2O2/c1-13(2,3)11(14)12(16)15-9-7-5-6-8-10(9)17-4/h5-8,11H,14H2,1-4H3,(H,15,16)/t11-/m1/s1
InChI key:InChIKey=XHIMPUVOYBUXDW-LLVKDONJSA-N
SMILES:N(C([C@H](C(C)(C)C)N)=O)C1=C(OC)C=CC=C1
Synonyms:
  • Butanamide, 2-amino-N-(2-methoxyphenyl)-3,3-dimethyl-, (S)-
  • (2S)-2-Amino-N-(2-methoxyphenyl)-3,3-dimethylbutanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.