CAS 17177-17-2

6-METHYL-2,3,4,9-TETRAHYDRO-1H-CARBAZOLE

Description:

6-Methyl-2,3,4,9-tetrahydro-1H-carbazole, with the CAS number 17177-17-2, is an organic compound belonging to the carbazole family, which is characterized by a fused ring structure containing nitrogen. This compound features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated form of the carbazole structure. The presence of a methyl group at the 6-position contributes to its unique chemical properties and potential reactivity. Typically, compounds in this class exhibit interesting biological activities, including potential applications in pharmaceuticals and materials science. The molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry. Additionally, its solubility and stability can vary based on the solvent and environmental conditions. Overall, 6-methyl-2,3,4,9-tetrahydro-1H-carbazole is a notable compound for research due to its structural features and potential applications in various fields.

Formula: C₁₃H₁₅N

InChI: InChI=1/C13H15N/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h6-8,14H,2-5H2,1H3

SMILES: Cc1ccc2c(c1)c1CCCCc1[nH]2

Synonyms:

• Akos B029838