CAS 17184-05-3
:3′H-Cyclopropa[1,2]pregna-1,4-diene-3,6,20-trione, 1β,2β-dihydro-17-hydroxy-, acetate
Description:
3′H-Cyclopropa[1,2]pregna-1,4-diene-3,6,20-trione, 1β,2β-dihydro-17-hydroxy-, acetate, commonly referred to by its CAS number 17184-05-3, is a synthetic steroid compound. It features a cyclopropane ring fused to a steroid backbone, which contributes to its unique structural and chemical properties. The presence of multiple functional groups, including hydroxyl and acetate moieties, indicates potential biological activity, particularly in hormone-related pathways. This compound is likely to exhibit characteristics typical of steroid hormones, such as binding to specific receptors and influencing various physiological processes. Its structural modifications may enhance its stability, solubility, or bioavailability compared to natural steroids. As with many steroid derivatives, it may be of interest in pharmacological research, particularly in the fields of endocrinology and reproductive health. However, detailed studies would be necessary to fully elucidate its biological effects, mechanisms of action, and potential therapeutic applications.
Formula:C24H30O5
InChI:InChI=1S/C24H30O5/c1-12(25)24(29-13(2)26)8-6-16-14-10-21(28)19-11-20(27)15-9-18(15)23(19,4)17(14)5-7-22(16,24)3/h11,14-18H,5-10H2,1-4H3/t14-,15+,16-,17-,18-,22-,23-,24-/m0/s1
InChI key:InChIKey=WIRUTYUSQYFQAC-FDTZYFLXSA-N
SMILES:C[C@]12[C@@]3([C@@](C3)(C(=O)C=C1C(=O)C[C@@]4([C@@]2(CC[C@@]5(C)[C@]4(CC[C@]5(OC(C)=O)C(C)=O)[H])[H])[H])[H])[H]
Synonyms:- 3′H-Cyclopropa[1,2]pregna-1,4-diene-3,6,20-trione, 1β,2β-dihydro-17-hydroxy-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Cyproterone Acetate EP Impurity E
CAS:Formula:C24H30O5Color and Shape:Yellow SolidMolecular weight:398.50


