CymitQuimica logo

CAS 171877-37-5

:

(R)-4-PHENYL-1,3-OXAZOLIDINE-2-THIONE

Description:
(R)-4-Phenyl-1,3-oxazolidine-2-thione is a chiral compound characterized by its oxazolidine ring structure, which incorporates both nitrogen and sulfur atoms. This compound features a phenyl group attached to the oxazolidine, contributing to its aromatic properties. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's reactivity and stability. As a chiral molecule, it exists in two enantiomeric forms, with the (R) configuration being significant in various applications, particularly in pharmaceuticals and asymmetric synthesis. The compound's unique structure allows it to participate in various chemical reactions, making it a valuable intermediate in organic synthesis. Its solubility and stability can vary depending on the solvent and conditions used, which is essential for its practical applications. Overall, (R)-4-Phenyl-1,3-oxazolidine-2-thione is notable for its potential use in drug development and as a building block in synthetic chemistry.
Formula:C9H9NOS
InChI:InChI=1/C9H9NOS/c12-9-10-8(6-11-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,10,12)/t8-/m0/s1
InChI key:LVIJIGQKFDZTNC-QMMMGPOBSA-N
SMILES:c1ccc(cc1)[C@@H]1COC(=N1)S
Synonyms:
  • (R)-4-Phenyloxazolidine-2-Thione
  • (4R)-4-phenyl-1,3-oxazolidine-2-thione
Found 5 products.