CAS 171879-99-5

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-6-methyl-

Description:

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-6-methyl- is a heterocyclic organic compound characterized by a fused bicyclic structure that incorporates both pyrrole and pyridine rings. This compound features a chlorine atom at the 4-position and a methyl group at the 6-position of the pyridine ring, which can influence its chemical reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine substituent can enhance its lipophilicity and potentially its pharmacological properties. Compounds of this class are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the structural features of 1H-Pyrrolo[2,3-b]pyridine derivatives can lead to diverse chemical behaviors, making them of interest in various fields, including agrochemicals and materials science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₈H₇ClN₂

InChI: InChI=1/C8H7ClN2/c1-5-4-7(9)6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11)

SMILES: Cc1cc(c2ccnc2[nH]1)Cl

Synonyms:

• 4-Chlor-6-methyl-1H-pyrrolo[2,3-b]pyridin
• 4-chloro-6-methyl-1H-pyrrolo[2,3-b]pyridine

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-6-methyl-

CAS: 171879-99-5

Formula: C₈H₇ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.6076

Ref: IN-DA00ABGS

4-Chloro-6-methyl-7-azaindole

CAS: 171879-99-5

4-Chloro-6-methyl-7-azaindole

Purity: 97%

Molecular weight: 166.611g/mol

Ref: 54-OR73930

4-Chloro-6-methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 171879-99-5

Formula: C₈H₇ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.61

Ref: 10-F209434