CymitQuimica logo

CAS 171887-04-0

:

(1S,4R)-4-[(2-Amino-6-chloro-5-formamide-4-pyrimidinyl)amino]-2-cyclopentene-1-methanol

Description:
The chemical substance known as (1S,4R)-4-[(2-Amino-6-chloro-5-formamide-4-pyrimidinyl)amino]-2-cyclopentene-1-methanol, with the CAS number 171887-04-0, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a cyclopentene ring, which contributes to its cyclic structure, and incorporates an amino group and a formamide moiety, indicating potential biological activity. The presence of chlorine in the pyrimidine ring suggests that it may exhibit unique reactivity or binding properties, which can be significant in medicinal chemistry. This compound is likely to be of interest in pharmaceutical research, particularly in the development of targeted therapies, due to its structural features that may interact with biological targets. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent, which are crucial for its application in drug formulation or biological assays. Overall, this compound exemplifies the intricate design often found in bioactive molecules.
Formula:C11H14ClN5O2
InChI:InChI=1S/C11H14ClN5O2/c12-9-8(14-5-19)10(17-11(13)16-9)15-7-2-1-6(3-7)4-18/h1-2,5-7,18H,3-4H2,(H,14,19)(H3,13,15,16,17)/t6-,7+/m1/s1
InChI key:OSFRHUVOPNVUGL-RQJHMYQMSA-N
SMILES:C1[C@@H](C=C[C@@H]1NC2=C(C(=NC(=N2)N)Cl)NC=O)CO
Synonyms:
  • N-[2-Amino-4-chloro-6-[[(1R,4S)-4-(hydroxymethyl)-2-cyclopenten-1-yl]amino]-5-pyrimidinyl]formamide
Found 3 products.