CAS 17193-31-6
:α-Aminobenzenepropanamide
Description:
α-Aminobenzenepropanamide, also known as phenylalanine amide, is an organic compound characterized by the presence of both an amine and an amide functional group. It features a phenyl group attached to a propanamide backbone, which contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The molecular structure allows for potential interactions with biological systems, making it of interest in pharmaceutical and biochemical research. α-Aminobenzenepropanamide can participate in various chemical reactions, including acylation and amination, and may serve as a precursor or intermediate in the synthesis of more complex molecules. Its stability and reactivity are influenced by the electronic effects of the phenyl group and the steric hindrance around the amine and amide functionalities. Overall, α-Aminobenzenepropanamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H2,11,12)
InChI key:InChIKey=OBSIQMZKFXFYLV-UHFFFAOYSA-N
SMILES:C(C(C(N)=O)N)C1=CC=CC=C1
Synonyms:- (±)-α-Aminobenzenepropanamide
- 2-Amino-3-phenylpropanamide
- 2-Amino-3-phenylpropionamide
- <span class="text-smallcaps">D</smallcap><smallcap>L</span>-Phenylalaninamide
- <span class="text-smallcaps">D</smallcap><smallcap>L</span>-Phenylalanine amide
- <span class="text-smallcaps">D</smallcap><smallcap>L</span>-α-Aminohydrocinnamamide
- Benzenepropanamide, α-amino-
- DL-Phenylalanine amide
- Hydrocinnamamide, α-amino-, <span class="text-smallcaps">D</smallcap><smallcap>L</span>-
- Phenylalaninamide
- Hydrocinnamamide, α-amino-, DL-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-3-phenylpropanamide
CAS:2-Amino-3-phenylpropanamide is a peptide hormone that has been shown to have biological properties in humans. It is the active form of 2-amino-3-phenylpropanoic acid, which is found in the human serum. This compound may be involved in bowel disease and diabetes. The protonated form of this compound binds to the CB2 receptor and inhibits inflammatory responses. 2-Amino-3-phenylpropanamide also has racemase activity and can be used as an amide or sodium salt. It has a ph optimum of 5.5 to 7.5 and exhibits receptor activity when it binds to opioid receptors, such as those that are expressed on peripheral sensory neurons.Formula:C9H12N2OPurity:Min. 95%Molecular weight:164.21 g/mol



