CAS 17194-82-0: (4-Hydroxyphenyl)acetamide
Description:(4-Hydroxyphenyl)acetamide, also known as paracetamol or acetaminophen, is an organic compound characterized by its aromatic structure and functional groups. It features a hydroxyl group (-OH) attached to a phenyl ring, which contributes to its solubility in water and its ability to form hydrogen bonds. The acetamide group (-NHCOCH3) enhances its pharmacological properties, making it a widely used analgesic and antipyretic agent. This compound is typically a white, crystalline solid with a melting point that varies depending on purity. It is known for its relatively low toxicity compared to other analgesics, making it suitable for over-the-counter use. In terms of reactivity, (4-Hydroxyphenyl)acetamide can undergo various chemical reactions, including acetylation and oxidation, and it is often involved in metabolic pathways in the human body. Its mechanism of action primarily involves the inhibition of cyclooxygenase enzymes, leading to reduced production of prostaglandins, which are mediators of pain and fever. Overall, its favorable safety profile and efficacy have made it a staple in pain management and fever reduction.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c9-8(11)5-6-1-3-7(10)4-2-6/h1-4,10H,5H2,(H2,9,11)
InChI key:InChIKey=YBPAYPRLUDCSEY-UHFFFAOYSA-N
SMILES:O=C(N)CC1=CC=C(O)C=C1
- Synonyms:
- (4-Hydroxyphenyl)acetamide
- (p-Hydroxyphenyl)acetamide
- 2-(4-Hydroxyphenyl)Acetamide
- 2-(p-Hydroxyphenyl)acetamide
- 4-Hydroxyphenylacetamide
- Acetamide, 2-(p-hydroxyphenyl)-
- Benzeneacetamide, 4-hydroxy-
- NSC 187193
- P-Hydroxy Pheny lacetamide
- Para-Hydroxy Phenyl Acetamide
- See more synonyms
- Phpa
- p-(Carbamoylmethyl)phenol
- 4-Hydroxybenzeneacetamide
