CAS 171973-67-4
:[(6S,7S,8R,8aR)-7-acetamido-6-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-phenacyloxy-propoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate
Description:
The chemical substance with the name "[(6S,7S,8R,8aR)-7-acetamido-6-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-phenacyloxy-propoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate" and CAS number "171973-67-4" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, esters, and phenolic components. This compound features a hexahydropyrano-dioxin core, which contributes to its potential biological activity. The presence of the fluorenylmethoxycarbonyl (Fmoc) group suggests applications in peptide synthesis and drug development, as Fmoc is commonly used for protecting amino groups during synthesis. Additionally, the compound's stereochemistry, indicated by the specific configuration at several chiral centers, may influence its pharmacological properties and interactions with biological targets. Overall, this substance is likely to be of interest in medicinal chemistry and pharmaceutical research due to its structural complexity and potential therapeutic applications.
Formula:C48H44N2O12
InChI:InChI=1/C48H44N2O12/c1-29(51)49-41-43(61-44(53)31-17-7-3-8-18-31)42-40(28-58-46(62-42)32-19-9-4-10-20-32)60-47(41)57-26-38(45(54)56-27-39(52)30-15-5-2-6-16-30)50-48(55)59-25-37-35-23-13-11-21-33(35)34-22-12-14-24-36(34)37/h2-24,37-38,40-43,46-47H,25-28H2,1H3,(H,49,51)(H,50,55)/t38-,40?,41-,42-,43+,46?,47-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
