CAS 17202-56-1

spiro[2.3]hexane-1-carboxylic acid

Description:

Spiro[2.3]hexane-1-carboxylic acid is a bicyclic organic compound characterized by its unique spiro structure, which consists of two rings that share a single carbon atom. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity. The spiro configuration contributes to its three-dimensional shape, influencing its physical and chemical properties, such as boiling point, solubility, and reactivity with other chemical species. Typically, spiro compounds exhibit interesting stereochemistry, which can affect their interactions in biological systems and materials science. The presence of the carboxylic acid group allows for potential applications in organic synthesis, where it can participate in various reactions, including esterification and decarboxylation. Additionally, the compound may serve as a building block in the synthesis of more complex molecules or materials. Overall, spiro[2.3]hexane-1-carboxylic acid is notable for its structural uniqueness and potential utility in chemical research and applications.

Formula: C₇H₁₀O₂

InChI: InChI=1/C7H10O2/c8-6(9)5-4-7(5)2-1-3-7/h5H,1-4H2,(H,8,9)

SMILES: C1CC2(C1)CC2C(=O)O

Synonyms:

• CHEMBRDG-BB 4003535
• 1-Carboxyspiro[2.3]hexane
• rac-(R)-spiro[2.3]hexane-1-carboxylic acid
• SPIRO[2.3]HEXANE-1-CARBOXYLIC ACID

Spiro[2.3]hexane-1-carboxylic acid

CAS: 17202-56-1

Formula: C₇H₁₀O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 126.1531

Ref: IN-DA00APRQ

Spiro[2.3]hexane-1-carboxylic acid

CAS: 17202-56-1

Spiro[2.3]hexane-1-carboxylic acid

Purity: 98%

Molecular weight: 126.15g/mol

Ref: 54-OR7101

Spiro[2.3]hexane-1-carboxylic acid

CAS: 17202-56-1

Formula: C₇H₁₀O₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 126.155

Ref: 10-F094202

Spiro[2.3]hexane-1-carboxylic acid

CAS: 17202-56-1

Please enquire for more information about Spiro[2.3]hexane-1-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₁₀O₂

Purity: Min. 95%

Molecular weight: 126.15 g/mol

Ref: 3D-FS167675