CAS 17202-57-2

Ethyl spiro[2.3]hexane-1-carboxylate

Description:

Ethyl spiro[2.3]hexane-1-carboxylate is an organic compound characterized by its unique spirocyclic structure, which features a bicyclic framework where two rings share a single carbon atom. This compound typically exhibits a colorless to pale yellow appearance and is known for its pleasant, fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Ethyl spiro[2.3]hexane-1-carboxylate is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the carboxylate group, which can participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the spiro structure can impart unique steric and electronic properties, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₄O₂

InChI: InChI=1S/C9H14O2/c1-2-11-8(10)7-6-9(7)4-3-5-9/h7H,2-6H2,1H3

InChI key: InChIKey=NMHNCGKWEZUMIX-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1C2(C1)CCC2

Synonyms:

• Spirohexane-1-carboxylic acid, ethyl ester
• Ethyl spiro[2.3]hexane-1-carboxylate
• Spiro[2.3]hexane-1-carboxylic acid, ethyl ester

Ethyl spiro[2.3]hexane-1-carboxylate

CAS: 17202-57-2

Versatile small molecule scaffold

Formula: C₉H₁₄O₂

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-SAA20257