CymitQuimica logo

CAS 17202-94-7

:

spiro[2.4]heptane-1-carboxylic acid

Description:
Spiro[2.4]heptane-1-carboxylic acid is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features a carboxylic acid functional group (-COOH) at the 1-position of the spiro system, contributing to its acidic properties. The presence of the carboxylic acid group allows for potential hydrogen bonding and reactivity typical of carboxylic acids, such as esterification and acid-base reactions. The spiro configuration imparts distinctive steric and electronic properties, influencing its reactivity and interactions with other molecules. This compound is of interest in organic synthesis and may serve as a building block for more complex molecules. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and the presence of functional groups. Overall, spiro[2.4]heptane-1-carboxylic acid exemplifies the intriguing chemistry associated with spiro compounds and their potential applications in various fields, including pharmaceuticals and materials science.
Formula:C8H12O2
InChI:InChI=1/C8H12O2/c9-7(10)6-5-8(6)3-1-2-4-8/h6H,1-5H2,(H,9,10)
InChI key:XYWFMXZFOVJDHK-UHFFFAOYSA-N
SMILES:C1CCC2(C1)CC2C(=O)O
Found 3 products.