CymitQuimica logo

CAS 17206-54-1

:

2-METHYL-2-PHENYL-CYCLOHEXANONE

Description:
2-Methyl-2-phenylcyclohexanone, with the CAS number 17206-54-1, is an organic compound classified as a ketone. It features a cyclohexane ring substituted with both a methyl group and a phenyl group, contributing to its unique structural characteristics. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The presence of the ketone functional group imparts reactivity, making it useful in various chemical reactions, including oxidation and reduction processes. Additionally, 2-methyl-2-phenylcyclohexanone is employed in the synthesis of fragrances and as an intermediate in organic synthesis. Its physical properties, such as boiling point and density, can vary based on purity and environmental conditions. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes and should be used in well-ventilated areas to avoid inhalation of vapors.
Formula:C13H16O
InChI:InChI=1/C13H16O/c1-13(10-6-5-9-12(13)14)11-7-3-2-4-8-11/h2-4,7-8H,5-6,9-10H2,1H3
SMILES:CC1(CCCCC1=O)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.