CAS 1721-58-0
:Methyl oleanonate
Description:
Methyl oleanonate is a natural triterpenoid compound derived from various plant sources, particularly in the family of Oleaceae. It is characterized by its molecular formula, which reflects its structure as an ester formed from oleanolic acid and methanol. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. Methyl oleanonate is known for its potential biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in pharmacological research. Its solubility is generally higher in organic solvents than in water, which is typical for many lipophilic compounds. Additionally, it has been studied for its role in traditional medicine and its potential applications in cosmetics and food industries due to its pleasant fragrance and possible health benefits. As with many natural products, the specific characteristics can vary based on the source and extraction methods used.
Formula:C31H48O3
InChI:InChI=1S/C31H48O3/c1-26(2)15-17-31(25(33)34-8)18-16-29(6)20(21(31)19-26)9-10-23-28(5)13-12-24(32)27(3,4)22(28)11-14-30(23,29)7/h9,21-23H,10-19H2,1-8H3/t21-,22-,23+,28-,29+,30+,31-/m0/s1
InChI key:InChIKey=PPMUFCXCVKVCSV-VNNAKPRGSA-N
SMILES:C(OC)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)C(=O)CC5)[H])[H])(CC(C)(C)CC2)[H]
Synonyms:- Oleanonic acid methyl ester
- Methyl oleanonate
- Olean-12-en-28-oic acid, 3-oxo-, methyl ester
- 3-Oxo-18β-olean-12-en-28-oic acid methyl ester
- Methyl-3-oxoolean-12-en-28-oate
- methyl 3-oxooleanolate
- 3-Oxoolean-12-en-28-oic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Oxo-olean-12-en-28-oic acid methyl ester
CAS:Formula:C31H48O3Purity:95%~99%Molecular weight:468.722Methyl oleanonate
CAS:3-Oxoolean-12-en-28-oic acid methyl ester is a triterpenoid PPARγ agonist isolated from Pistacia with anticancer properties.Formula:C31H48O3Purity:98.99%Color and Shape:SolidMolecular weight:468.71Methyl oleanonate
CAS:Methyl oleanonate is a triterpenoid compound, which is a derivative of oleanolic acid. It is isolated from various plant sources, including medicinal herbs and shrubs known for their therapeutic properties. This compound is particularly abundant in species within the Oleaceae and Lamiaceae families, where it can be extracted through specialized biochemical processes.
Formula:C31H48O3Purity:Min. 95%Molecular weight:468.7 g/molRef: 3D-BAA72158
Discontinued product





