CAS 172155-07-6
:Perfluoro-3,7-dimethyloctanoic acid
Description:
Perfluoro-3,7-dimethyloctanoic acid (CAS 172155-07-6) is a perfluorinated carboxylic acid characterized by a long carbon chain fully saturated with fluorine atoms, which imparts unique properties. This compound features a branched structure with two methyl groups located at the 3rd and 7th positions of the octanoic acid backbone. The presence of fluorine atoms enhances its hydrophobicity and lipophobicity, making it resistant to degradation and contributing to its stability in various environmental conditions. Perfluoro-3,7-dimethyloctanoic acid is known for its surfactant properties, which can affect surface tension and wetting behavior in formulations. Additionally, like other perfluorinated compounds, it may exhibit bioaccumulation potential and persistence in the environment, raising concerns regarding its ecological impact and human health. Regulatory scrutiny has increased for such substances due to their association with adverse effects, leading to ongoing research into their behavior, fate, and potential alternatives in industrial applications.
Formula:C10HF19O2
InChI:InChI=1/C10HF19O2/c11-2(12,1(30)31)3(13,8(21,22)23)5(15,16)7(19,20)6(17,18)4(14,9(24,25)26)10(27,28)29/h(H,30,31)
SMILES:C(=O)(C(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)O
Synonyms:- 2,2,3,4,4,5,5,6,6,7,8,8,8-Tridecafluoro-3,7-Bis(Trifluoromethyl)Octanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Perfluoro(3,7-bis(trifluoromethyl))octanoic acid
CAS:Controlled ProductFormula:C10HF19O2Color and Shape:NeatMolecular weight:514.08Perfluoro(3,7-bis(trifluoromethyl))octanoic acid 50 µg/mL in Methanol:Water
CAS:Color and Shape:ColourlessPerfluoro(3,7-dimethyloctanoic acid)
CAS:Perfluoro(3,7-dimethyloctanoic acid)Formula:C10HF19O2Purity:97%Color and Shape: clear liquidMolecular weight:514.08g/mol2,2,3,4,4,5,5,6,6,7,8,8,8-Tridecafluoro-3,7-bis(trifluoromethyl)-octanoic Acid
CAS:Applications 2,2,3,4,4,5,5,6,6,7,8,8,8-Tridecafluoro-3,7-bis(trifluoromethyl)-octanoic Acid is used to tune lipase activity. It is also known for being an environmental pollutant.
References Acevedo-Rocha, C. et al.: Cat. Sci. Tech., 2, 1553 (2012);Formula:C10HF19O2Color and Shape:ColourlessMolecular weight:514.08Perfluoro-3,7-dimethyloctanoic acid
CAS:Formula:C10HF19O2Purity:97%Color and Shape:LiquidMolecular weight:514.086





