CAS 17216-10-3: 1,3-Bis(1-naphthalenyloxy)-2-propanol
Description:1,3-Bis(1-naphthalenyloxy)-2-propanol, with the CAS number 17216-10-3, is an organic compound characterized by its unique structure that features two naphthalenyl groups attached to a central propanol moiety. This compound is typically a solid at room temperature and exhibits a relatively high molecular weight due to the presence of the bulky naphthalene rings. It is known for its potential applications in various fields, including pharmaceuticals and materials science, owing to its interesting chemical properties. The presence of the naphthalenyl groups contributes to its hydrophobic characteristics, which can influence its solubility in organic solvents. Additionally, the compound may exhibit specific optical properties due to the conjugated system of the naphthalene rings, making it of interest in studies related to photochemistry and fluorescence. Its reactivity can be influenced by the hydroxyl group, which may participate in hydrogen bonding and other interactions, affecting its behavior in different chemical environments. Overall, 1,3-Bis(1-naphthalenyloxy)-2-propanol is a compound of interest for further research and application development.
Formula:C23H20O3
InChI:InChI=1S/C23H20O3/c24-19(15-25-22-13-5-9-17-7-1-3-11-20(17)22)16-26-23-14-6-10-18-8-2-4-12-21(18)23/h1-14,19,24H,15-16H2
InChI key:InChIKey=PKZXCEVVANTTGF-UHFFFAOYSA-N
SMILES:OC(COC1=CC=CC=2C=CC=CC12)COC3=CC=CC=4C=CC=CC34
- Synonyms:
- 2-Propanol, 1,3-bis(1-naphthyloxy)-
- 1,3-Bis(1-naphthoxy)-2-propanol
- 1,3-Bis(naphthalen-1-yloxy)propan-2-ol
- 2-Propanol, 1,3-bis(1-naphthalenyloxy)-
- 1,3-Bis(1-naphthalenyloxy)-2-propanol

Propranolol EP Impurity C (Propranolol Bis-ether Derivative)
Ref: 4Z-P-1613
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

1,3-Bis(naphthalen-1-yloxy)propan-2-ol (Bis-ether Derivative)
Ref: 86-MM0043.02-0025
25mg | 1,003.00 € |

1,3-Bis(1-naphthalenyloxy)-2-propanol
Ref: TR-B504300
5g | 2,333.00 € | ||
500mg | 362.00 € |

1,3-Bis(1-naphthalenyloxy)-2-propanol-d5
Controlled ProductRef: TR-B504302
5mg | 1,136.00 € |

1,3-Bis(1-naphthalenyloxy)-2-propanol
Ref: 3D-SAA21610
50mg | 676.00 € | ||
500mg | 1,883.00 € |