CymitQuimica logo

CAS 172163-62-1

:

7-Deaza-2'-deoxy-7-iodoguanosine

Description:
7-Deaza-2'-deoxy-7-iodoguanosine is a modified nucleoside that features a deazapurine structure, where the nitrogen atom at the 7-position of guanine is replaced by a carbon atom. This modification alters its biochemical properties, making it of interest in various fields such as medicinal chemistry and molecular biology. The presence of an iodine atom at the 7-position enhances its potential for use in radiolabeling and imaging applications. As a nucleoside, it consists of a sugar moiety (2'-deoxyribose) linked to a modified purine base, which can influence its interactions with nucleic acids and enzymes. This compound may exhibit unique pharmacological properties, including potential antiviral or anticancer activities, due to its structural modifications. Its solubility, stability, and reactivity can differ from those of standard nucleosides, making it a valuable tool for research in nucleic acid chemistry and therapeutic development. Overall, 7-Deaza-2'-deoxy-7-iodoguanosine represents a significant compound for exploring new biochemical pathways and therapeutic strategies.
Formula:C11H13IN4O4
InChI:InChI=1S/C11H13IN4O4/c12-4-2-16(7-1-5(18)6(3-17)20-7)9-8(4)10(19)15-11(13)14-9/h2,5-7,17-18H,1,3H2,(H3,13,14,15,19)/t5-,6+,7+/m0/s1
InChI key:TVQBNMOSBBMRCZ-RRKCRQDMSA-N
SMILES:C1[C@@H]([C@H](O[C@H]1N2C=C(C3=C2N=C(NC3=O)N)I)CO)O
Synonyms:
  • 7-Deaza-7-Iodo-2'-DeoxyGuanosine
Found 7 products.