CymitQuimica logo

CAS 172169-88-9

:

(2S)-4-bromo-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid

Description:
(2S)-4-bromo-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid is a synthetic amino acid derivative characterized by its unique structural features. It contains a bromine atom at the 4-position of the butanoic acid backbone, which contributes to its reactivity and potential biological activity. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates that this compound is likely used in peptide synthesis, serving as a protective group for the amino functionality. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in synthetic chemistry. The compound's chirality is indicated by the (2S) configuration, which is crucial for its biological interactions and properties. Overall, this compound is of interest in the fields of medicinal chemistry and biochemistry, particularly in the development of peptide-based therapeutics and research applications. Its specific characteristics, including solubility and stability, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C19H18BrNO4
InChI:InChI=1/C19H18BrNO4/c20-10-9-17(18(22)23)21-19(24)25-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,21,24)(H,22,23)/t17-/m0/s1
InChI key:WRUVVOOOVOSSKP-KRWDZBQOSA-N
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](CCBr)C(=O)O)O
Found 5 products.