CymitQuimica logo

CAS 172215-91-7

:

3-Bromo-4-(trifluoromethyl)aniline

Description:
3-Bromo-4-(trifluoromethyl)aniline is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to an aniline structure. Its molecular formula is C7H5BrF3N, indicating that it contains seven carbon atoms, five hydrogen atoms, one bromine atom, three fluorine atoms, and one nitrogen atom. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of the trifluoromethyl group, which can enhance biological activity and lipophilicity. The bromine substituent can also influence the compound's reactivity and stability. In terms of solubility, it may exhibit limited solubility in water but is likely soluble in organic solvents. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3-Bromo-4-(trifluoromethyl)aniline is a valuable compound in synthetic organic chemistry, particularly in the development of new materials and biologically active molecules.
Formula:C7H5BrF3N
InChI:InChI=1S/C7H5BrF3N/c8-6-3-4(12)1-2-5(6)7(9,10)11/h1-3H,12H2
InChI key:VMERAUXEEDONDK-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1N)Br)C(F)(F)F
Found 4 products.