CAS 17223-85-7
:9H-carbazol-9-amine
Description:
9H-Carbazol-9-amine, also known as carbazole-9-amine, is an organic compound characterized by its structure, which features a carbazole moiety with an amino group at the 9-position. This compound is typically a white to light yellow solid and is known for its aromatic properties due to the presence of the fused benzene rings in the carbazole structure. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. 9H-Carbazol-9-amine exhibits interesting photophysical properties, making it a subject of research in organic electronics, particularly in the development of light-emitting diodes (LEDs) and organic solar cells. Additionally, it has potential applications in the synthesis of dyes and pigments. The compound may also exhibit biological activity, which has led to studies exploring its potential as a pharmaceutical agent. As with many amines, it is important to handle this compound with care due to its potential reactivity and toxicity.
Formula:C12H10N2
InChI:InChI=1/C12H10N2/c13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H,13H2
SMILES:c1ccc2c(c1)c1ccccc1n2N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9-Aminocarbazole
CAS:9-AminocarbazoleFormula:C12H10N2Purity:≥95%Color and Shape: grey powderMolecular weight:182.22g/mol9H-Carbazol-9-amine
CAS:9H-Carbazol-9-amine is an amine used as a fluorescent probe in the study of Alzheimer's disease. It has been shown to quench fluorescence from other substances, and can be used to detect the presence of chloride ions. 9H-Carbazol-9-amine has been shown to bind to DNA via hydrogen bonding, which may help elucidate the mechanism by which it inhibits the production of amyloid beta peptides and prevents neuronal cell death. 9H-Carbazol-9-amine is also a cholinergic agent that binds to acetylcholine receptors on nerve cells and increases their activity.Formula:C12H10N2Purity:Min. 95%Molecular weight:182.22 g/mol
