CAS 172349-10-9

2-Thiophenecarbonitrile, 5-(aminomethyl)-, hydrochloride (1:1)

Description:

2-Thiophenecarbonitrile, 5-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a carbonitrile group indicates a cyano functional group (-C≡N) attached to the thiophene, contributing to its reactivity and potential applications in organic synthesis. The aminomethyl substituent suggests the presence of an amine group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical contexts. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and spectral characteristics, would depend on the conditions and purity of the sample. Overall, 2-Thiophenecarbonitrile, 5-(aminomethyl)-, hydrochloride is a versatile compound with potential applications in various fields, including drug development and materials science.

Formula: C₆H₆N₂S·ClH

InChI: InChI=1S/C6H6N2S.ClH/c7-3-5-1-2-6(4-8)9-5;/h1-2H,3,7H2;1H

InChI key: InChIKey=ORXSASOZUVSWPV-UHFFFAOYSA-N

SMILES: C(N)C=1SC(C#N)=CC1.Cl

Synonyms:

• 2-Thiophenecarbonitrile, 5-(aminomethyl)-, hydrochloride (1:1)
• 2-Thiophenecarbonitrile, 5-(aminomethyl)-, monohydrochloride
• 5-(Aminomethyl)Thiophene-2-Carbonitrile Hydrochloride

5-(Aminomethyl)thiophene-2-carbonitrile hydrochloride

CAS: 172349-10-9

Formula: C₆H₇ClN₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 174.65

Ref: 10-F318304