CymitQuimica logo

CAS 17238-58-3

:

1-carboxamidino-4-phenylpiperazine

Description:
1-Carboxamidino-4-phenylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxamidino group, which contributes to its potential biological activity, particularly in pharmacology. The presence of the phenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. The structural configuration allows for various interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as being a potential ligand for certain receptors or enzymes, and its derivatives could be explored for therapeutic applications. Additionally, its solubility and stability in different solvents can vary, impacting its formulation in drug development. Overall, 1-carboxamidino-4-phenylpiperazine represents a unique scaffold for further research in drug discovery and development, particularly in the context of neuropharmacology and other therapeutic areas.
Formula:C22H34N8O4S
InChI:InChI=1/2C11H16N4.H2O4S/c2*12-11(13)15-8-6-14(7-9-15)10-4-2-1-3-5-10;1-5(2,3)4/h2*1-5H,6-9H2,(H3,12,13);(H2,1,2,3,4)
SMILES:c1ccc(cc1)N1CCN(CC1)C(=N)N.c1ccc(cc1)N1CCN(CC1)C(=N)N.OS(=O)(=O)O
Synonyms:
  • 1-Capp
  • 1-Piperazinecarboximidamide, 4-phenyl-
  • 4-Phenylpiperazine-1-Carboximidamide
  • 4-Phenylpiperazine-1-Carboximidamide Sulfate (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.